C16H23IN4S — CID 110947847
1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide (PubChem CID 110947847) has the molecular formula C16H23IN4S and a molecular weight of 430.36 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110947847 |
| Molecular Formula | C16H23IN4S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnc(C)s1)NC(C)c1ccccc1.I |
| InChI | InChI=1S/C16H22N4S.HI/c1-4-17-16(19-11-15-10-18-13(3)21-15)20-12(2)14-8-6-5-7-9-14;/h5-10,12H,4,11H2,1-3H3,(H2,17,19,20);1H |
| InChIKey | QIJYAJMHHSXGJV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|