C16H23IN4OS — CID 111004624
1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111004624) has the molecular formula C16H23IN4OS and a molecular weight of 446.36 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111004624 |
| Molecular Formula | C16H23IN4OS |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnc(C)s1)NCCOc1ccccc1.I |
| InChI | InChI=1S/C16H22N4OS.HI/c1-3-17-16(20-12-15-11-19-13(2)22-15)18-9-10-21-14-7-5-4-6-8-14;/h4-8,11H,3,9-10,12H2,1-2H3,(H2,17,18,20);1H |
| InChIKey | NCDXNHQSVKEADM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|