C17H25IN4OS — CID 111832548
1-ethyl-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111832548) has the molecular formula C17H25IN4OS and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-ethyl-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111832548 |
| Molecular Formula | C17H25IN4OS |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-ethyl-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(CC)n1)NCCOc1ccccc1.I |
| InChI | InChI=1S/C17H24N4OS.HI/c1-3-16-21-14(13-23-16)12-20-17(18-4-2)19-10-11-22-15-8-6-5-7-9-15;/h5-9,13H,3-4,10-12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | IBRKWBXIHCZFRW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|