C16H27BrIN3O2 — CID 110966081
2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-tert-butyl-3-ethylguanidine;hydroiodide (PubChem CID 110966081) has the molecular formula C16H27BrIN3O2 and a molecular weight of 500.22 g/mol. Its IUPAC name is 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-tert-butyl-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-tert-butyl-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110966081 |
| Molecular Formula | C16H27BrIN3O2 |
| Molecular Weight | 500.22 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-tert-butyl-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)c(OC)c(OC)c1)NC(C)(C)C.I |
| InChI | InChI=1S/C16H26BrN3O2.HI/c1-7-18-15(20-16(2,3)4)19-10-11-8-12(17)14(22-6)13(9-11)21-5;/h8-9H,7,10H2,1-6H3,(H2,18,19,20);1H |
| InChIKey | IOMWYGIQZBWBLO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.22 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|