C20H34N4O4 — CID 111376848
N-[2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111376848) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111376848 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H34N4O4/c1-8-21-19(23-10-9-22-18(25)20(2,3)4)24-13-14-11-15(26-5)17(28-7)16(12-14)27-6/h11-12H,8-10,13H2,1-7H3,(H,22,25)(H2,21,23,24) |
| InChIKey | AWYIETDHCKRLPL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|