C20H33IN4O4 — CID 111376381
N-cyclopropyl-4-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]butanamide;hydroiodide (PubChem CID 111376381) has the molecular formula C20H33IN4O4 and a molecular weight of 520.41 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111376381 |
| Molecular Formula | C20H33IN4O4 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N-cyclopropyl-4-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]butanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCCCC(=O)NC1CC1.I |
| InChI | InChI=1S/C20H32N4O4.HI/c1-5-21-20(22-10-6-7-18(25)24-15-8-9-15)23-13-14-11-16(26-2)19(28-4)17(12-14)27-3;/h11-12,15H,5-10,13H2,1-4H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | WUFJOWZJBQURLP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|