C18H28N4O4 — CID 111378001
N-cyclopropyl-2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111378001) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-cyclopropyl-2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-cyclopropyl-2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111378001 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | N-cyclopropyl-2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCC(=O)NC1CC1 |
| InChI | InChI=1S/C18H28N4O4/c1-5-19-18(21-11-16(23)22-13-6-7-13)20-10-12-8-14(24-2)17(26-4)15(9-12)25-3/h8-9,13H,5-7,10-11H2,1-4H3,(H,22,23)(H2,19,20,21) |
| InChIKey | LEIKNBMTZCTALP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|