C23H33IN4O5 — CID 111377802
2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide (PubChem CID 111377802) has the molecular formula C23H33IN4O5 and a molecular weight of 572.44 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111377802 |
| Molecular Formula | C23H33IN4O5 |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | 2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCC(=O)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C23H32N4O5.HI/c1-6-24-23(26-14-17-11-19(30-3)22(32-5)20(12-17)31-4)27-15-21(28)25-13-16-7-9-18(29-2)10-8-16;/h7-12H,6,13-15H2,1-5H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | CERLQJQJODNPFL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|