C21H27FN4O4 — CID 111376542
2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 111376542) has the molecular formula C21H27FN4O4 and a molecular weight of 418.47 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111376542 |
| Molecular Formula | C21H27FN4O4 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN4O4/c1-5-23-21(25-13-19(27)26-16-8-6-15(22)7-9-16)24-12-14-10-17(28-2)20(30-4)18(11-14)29-3/h6-11H,5,12-13H2,1-4H3,(H,26,27)(H2,23,24,25) |
| InChIKey | BSZVTBGIBGTUJA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|