C16H20FIN4OS — CID 111939122
2-[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111939122) has the molecular formula C16H20FIN4OS and a molecular weight of 462.33 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111939122 |
| Molecular Formula | C16H20FIN4OS |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 2-[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCC(=O)Nc1ccc(F)cc1.I |
| InChI | InChI=1S/C16H19FN4OS.HI/c1-2-18-16(19-9-12-7-8-23-11-12)20-10-15(22)21-14-5-3-13(17)4-6-14;/h3-8,11H,2,9-10H2,1H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | WGLKDBCHSLJGPB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|