C20H23IN4O2S — CID 111940574
N-[4-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111940574) has the molecular formula C20H23IN4O2S and a molecular weight of 510.40 g/mol. Its IUPAC name is N-[4-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111940574 |
| Molecular Formula | C20H23IN4O2S |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-[4-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCc1ccc(NC(=O)c2ccco2)cc1.I |
| InChI | InChI=1S/C20H22N4O2S.HI/c1-2-21-20(23-13-16-9-11-27-14-16)22-12-15-5-7-17(8-6-15)24-19(25)18-4-3-10-26-18;/h3-11,14H,2,12-13H2,1H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | PLWIIAJMTDEEKR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|