C19H25IN4O2 — CID 111869777
N-[4-[[[(cyclopropylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111869777) has the molecular formula C19H25IN4O2 and a molecular weight of 468.34 g/mol. Its IUPAC name is N-[4-[[[(cyclopropylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[(cyclopropylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111869777 |
| Molecular Formula | C19H25IN4O2 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-[4-[[[(cyclopropylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)c2ccco2)cc1)NCC1CC1.I |
| InChI | InChI=1S/C19H24N4O2.HI/c1-2-20-19(21-12-14-5-6-14)22-13-15-7-9-16(10-8-15)23-18(24)17-4-3-11-25-17;/h3-4,7-11,14H,2,5-6,12-13H2,1H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | MZVPESLULQFUEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|