C18H22N4O2 — CID 110988092
N-[4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 110988092) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110988092 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)c2ccco2)cc1)NC1CC1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-19-18(22-15-9-10-15)20-12-13-5-7-14(8-6-13)21-17(23)16-4-3-11-24-16/h3-8,11,15H,2,9-10,12H2,1H3,(H,21,23)(H2,19,20,22) |
| InChIKey | DXZZAPVYPHHYPG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|