C19H25IN4O4S — CID 111141686
N-[4-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111141686) has the molecular formula C19H25IN4O4S and a molecular weight of 532.40 g/mol. Its IUPAC name is N-[4-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111141686 |
| Molecular Formula | C19H25IN4O4S |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | N-[4-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)c2ccco2)cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C19H24N4O4S.HI/c1-2-20-19(23-16-9-11-28(25,26)13-16)21-12-14-5-7-15(8-6-14)22-18(24)17-4-3-10-27-17;/h3-8,10,16H,2,9,11-13H2,1H3,(H,22,24)(H2,20,21,23);1H |
| InChIKey | BAVZOGNVPAHYJC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|