C20H27IN4O4S — CID 111140872
3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]-N-(furan-2-ylmethyl)benzamide;hydroiodide (PubChem CID 111140872) has the molecular formula C20H27IN4O4S and a molecular weight of 546.43 g/mol. Its IUPAC name is 3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]-N-(furan-2-ylmethyl)benzamide;hydroiodide.
| Compound Name | 3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]-N-(furan-2-ylmethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111140872 |
| Molecular Formula | C20H27IN4O4S |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]-N-(furan-2-ylmethyl)benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCc2ccco2)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C20H26N4O4S.HI/c1-2-21-20(24-17-8-10-29(26,27)14-17)23-12-15-5-3-6-16(11-15)19(25)22-13-18-7-4-9-28-18;/h3-7,9,11,17H,2,8,10,12-14H2,1H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | NSJXLHZAOYUFLH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|