C23H26FIN4O2 — CID 111853971
N-[4-[[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111853971) has the molecular formula C23H26FIN4O2 and a molecular weight of 536.39 g/mol. Its IUPAC name is N-[4-[[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111853971 |
| Molecular Formula | C23H26FIN4O2 |
| Molecular Weight | 536.39 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | N-[4-[[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(C)c1)NCc1ccc(NC(=O)c2ccco2)cc1.I |
| InChI | InChI=1S/C23H25FN4O2.HI/c1-3-25-23(27-15-18-8-11-20(24)16(2)13-18)26-14-17-6-9-19(10-7-17)28-22(29)21-5-4-12-30-21;/h4-13H,3,14-15H2,1-2H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | HYCINYMHWHETDH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|