C17H21FIN5O — CID 111231022
2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 111231022) has the molecular formula C17H21FIN5O and a molecular weight of 457.29 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111231022 |
| Molecular Formula | C17H21FIN5O |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCC(=O)Nc1cccnc1.I |
| InChI | InChI=1S/C17H20FN5O.HI/c1-2-20-17(21-10-13-5-7-14(18)8-6-13)22-12-16(24)23-15-4-3-9-19-11-15;/h3-9,11H,2,10,12H2,1H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | CBNMWMHXNZDSQH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|