C18H23FIN5O — CID 111854011
2-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 111854011) has the molecular formula C18H23FIN5O and a molecular weight of 471.32 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111854011 |
| Molecular Formula | C18H23FIN5O |
| Molecular Weight | 471.32 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 2-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(C)c1)NCC(=O)Nc1cccnc1.I |
| InChI | InChI=1S/C18H22FN5O.HI/c1-3-21-18(22-10-14-6-7-16(19)13(2)9-14)23-12-17(25)24-15-5-4-8-20-11-15;/h4-9,11H,3,10,12H2,1-2H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | GHKIJNYEMNWEGA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|