C17H28FIN4O — CID 111854367
3-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide (PubChem CID 111854367) has the molecular formula C17H28FIN4O and a molecular weight of 450.34 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111854367 |
| Molecular Formula | C17H28FIN4O |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 3-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CCN/C(=N/Cc1ccc(F)c(C)c1)NCC.I |
| InChI | InChI=1S/C17H27FN4O.HI/c1-4-9-20-16(23)8-10-21-17(19-5-2)22-12-14-6-7-15(18)13(3)11-14;/h6-7,11H,4-5,8-10,12H2,1-3H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | KNLUSKWUYFHKDP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|