C20H27FIN5O — CID 111854165
3-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 111854165) has the molecular formula C20H27FIN5O and a molecular weight of 499.37 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111854165 |
| Molecular Formula | C20H27FIN5O |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3-[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(C)c1)NCCC(=O)Nc1cccc(C)n1.I |
| InChI | InChI=1S/C20H26FN5O.HI/c1-4-22-20(24-13-16-8-9-17(21)14(2)12-16)23-11-10-19(27)26-18-7-5-6-15(3)25-18;/h5-9,12H,4,10-11,13H2,1-3H3,(H2,22,23,24)(H,25,26,27);1H |
| InChIKey | JZDMIRYOWWCMPA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|