C18H30N6O2 — CID 111384019
3-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide (PubChem CID 111384019) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 3-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111384019 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 3-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCC(=O)Nc1cccc(C)n1 |
| InChI | InChI=1S/C18H30N6O2/c1-6-19-17(21-12-16(26)24-18(3,4)5)20-11-10-15(25)23-14-9-7-8-13(2)22-14/h7-9H,6,10-12H2,1-5H3,(H,24,26)(H2,19,20,21)(H,22,23,25) |
| InChIKey | JRJHYBFPLDRAPT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|