C15H26IN5O2 — CID 110942643
3-[[N-ethyl-N'-(2-methoxyethyl)carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 110942643) has the molecular formula C15H26IN5O2 and a molecular weight of 435.31 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(2-methoxyethyl)carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-(2-methoxyethyl)carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 110942643 |
| Molecular Formula | C15H26IN5O2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-[[N-ethyl-N'-(2-methoxyethyl)carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCOC)NCCC(=O)Nc1cccc(C)n1.I |
| InChI | InChI=1S/C15H25N5O2.HI/c1-4-16-15(18-10-11-22-3)17-9-8-14(21)20-13-7-5-6-12(2)19-13;/h5-7H,4,8-11H2,1-3H3,(H2,16,17,18)(H,19,20,21);1H |
| InChIKey | GKVNTWHGZTXVAT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|