C23H34IN5O2 — CID 111403200
3-[[N-ethyl-N'-[3-(1-phenylethoxy)propyl]carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 111403200) has the molecular formula C23H34IN5O2 and a molecular weight of 539.46 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[3-(1-phenylethoxy)propyl]carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-[3-(1-phenylethoxy)propyl]carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111403200 |
| Molecular Formula | C23H34IN5O2 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 3-[[N-ethyl-N'-[3-(1-phenylethoxy)propyl]carbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOC(C)c1ccccc1)NCCC(=O)Nc1cccc(C)n1.I |
| InChI | InChI=1S/C23H33N5O2.HI/c1-4-24-23(25-15-9-17-30-19(3)20-11-6-5-7-12-20)26-16-14-22(29)28-21-13-8-10-18(2)27-21;/h5-8,10-13,19H,4,9,14-17H2,1-3H3,(H2,24,25,26)(H,27,28,29);1H |
| InChIKey | BRPVOTDXOQPKTR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|