C18H23FN4OS — CID 111941085
2-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111941085) has the molecular formula C18H23FN4OS and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111941085 |
| Molecular Formula | C18H23FN4OS |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C18H23FN4OS/c1-2-21-18(22-10-14-7-8-25-12-14)23-11-15(17(20)24)9-13-3-5-16(19)6-4-13/h3-8,12,15H,2,9-11H2,1H3,(H2,20,24)(H2,21,22,23) |
| InChIKey | RPVOYSAIIKQXOW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|