C20H31FN4O — CID 109470838
2-[[[N-ethyl-N'-[(1-ethylcyclobutyl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 109470838) has the molecular formula C20H31FN4O and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-[[[N-ethyl-N'-[(1-ethylcyclobutyl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-ethyl-N'-[(1-ethylcyclobutyl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 109470838 |
| Molecular Formula | C20H31FN4O |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-[[[N-ethyl-N'-[(1-ethylcyclobutyl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCN/C(=N\CC1(CC)CCC1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C20H31FN4O/c1-3-20(10-5-11-20)14-25-19(23-4-2)24-13-16(18(22)26)12-15-6-8-17(21)9-7-15/h6-9,16H,3-5,10-14H2,1-2H3,(H2,22,26)(H2,23,24,25) |
| InChIKey | WWWMLRDLASUFKY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|