C21H24F4N4O — CID 111268401
2-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111268401) has the molecular formula C21H24F4N4O and a molecular weight of 424.44 g/mol. Its IUPAC name is 2-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111268401 |
| Molecular Formula | C21H24F4N4O |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C21H24F4N4O/c1-2-27-20(28-12-15-4-3-5-17(11-15)21(23,24)25)29-13-16(19(26)30)10-14-6-8-18(22)9-7-14/h3-9,11,16H,2,10,12-13H2,1H3,(H2,26,30)(H2,27,28,29) |
| InChIKey | YPVZBIFDRQVAGF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|