C17H19F3N4O2 — CID 111908389
5-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide (PubChem CID 111908389) has the molecular formula C17H19F3N4O2 and a molecular weight of 368.36 g/mol. Its IUPAC name is 5-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111908389 |
| Molecular Formula | C17H19F3N4O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 5-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1ccc(C(N)=O)o1 |
| InChI | InChI=1S/C17H19F3N4O2/c1-2-22-16(24-10-13-6-7-14(26-13)15(21)25)23-9-11-4-3-5-12(8-11)17(18,19)20/h3-8H,2,9-10H2,1H3,(H2,21,25)(H2,22,23,24) |
| InChIKey | GEBKMTYSCPEBCK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|