C16H20FIN4O2 — CID 111908312
5-[[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide (PubChem CID 111908312) has the molecular formula C16H20FIN4O2 and a molecular weight of 446.26 g/mol. Its IUPAC name is 5-[[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 5-[[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111908312 |
| Molecular Formula | C16H20FIN4O2 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 5-[[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCc1ccc(C(N)=O)o1.I |
| InChI | InChI=1S/C16H19FN4O2.HI/c1-2-19-16(20-9-11-3-5-12(17)6-4-11)21-10-13-7-8-14(23-13)15(18)22;/h3-8H,2,9-10H2,1H3,(H2,18,22)(H2,19,20,21);1H |
| InChIKey | KVMIOHOFJOTPNS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|