C18H25IN4O4 — CID 111908254
5-[[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide (PubChem CID 111908254) has the molecular formula C18H25IN4O4 and a molecular weight of 488.33 g/mol. Its IUPAC name is 5-[[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 5-[[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111908254 |
| Molecular Formula | C18H25IN4O4 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 5-[[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCc1ccc(C(N)=O)o1.I |
| InChI | InChI=1S/C18H24N4O4.HI/c1-4-20-18(22-11-13-6-8-15(26-13)17(19)23)21-10-12-5-7-14(24-2)16(9-12)25-3;/h5-9H,4,10-11H2,1-3H3,(H2,19,23)(H2,20,21,22);1H |
| InChIKey | OPAHCBADJMCLFL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|