C19H24BrN3O2 — CID 111749856
1-[(4-bromophenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine (PubChem CID 111749856) has the molecular formula C19H24BrN3O2 and a molecular weight of 406.32 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111749856 |
| Molecular Formula | C19H24BrN3O2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H24BrN3O2/c1-4-21-19(22-12-14-5-8-16(20)9-6-14)23-13-15-7-10-17(24-2)18(11-15)25-3/h5-11H,4,12-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | NUFPUSGZCPFIEH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|