C17H23BrIN3O2S — CID 111201785
1-[(4-bromothiophen-2-yl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111201785) has the molecular formula C17H23BrIN3O2S and a molecular weight of 540.27 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111201785 |
| Molecular Formula | C17H23BrIN3O2S |
| Molecular Weight | 540.27 g/mol |
| Exact Mass | 538.97 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCc1cc(Br)cs1.I |
| InChI | InChI=1S/C17H22BrN3O2S.HI/c1-4-19-17(21-10-14-8-13(18)11-24-14)20-9-12-5-6-15(22-2)16(7-12)23-3;/h5-8,11H,4,9-10H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | GBUYOPNVXKHQID-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|