C18H27N5O2S — CID 111964417
2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine (PubChem CID 111964417) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111964417 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCc1csc(N(C)C)n1 |
| InChI | InChI=1S/C18H27N5O2S/c1-6-19-17(21-11-14-12-26-18(22-14)23(2)3)20-10-13-7-8-15(24-4)16(9-13)25-5/h7-9,12H,6,10-11H2,1-5H3,(H2,19,20,21) |
| InChIKey | RHQZSLSLMUVGPJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|