C16H24IN5O2S — CID 111600738
2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111600738) has the molecular formula C16H24IN5O2S and a molecular weight of 477.37 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111600738 |
| Molecular Formula | C16H24IN5O2S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCc2csc(N(C)C)n2)cc1OC.I |
| InChI | InChI=1S/C16H23N5O2S.HI/c1-21(2)16-20-12(10-24-16)9-19-15(17)18-8-11-5-6-13(22-3)14(7-11)23-4;/h5-7,10H,8-9H2,1-4H3,(H3,17,18,19);1H |
| InChIKey | NALFALWKZHBYOJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|