C22H27IN4O2S — CID 111911707
2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111911707) has the molecular formula C22H27IN4O2S and a molecular weight of 538.46 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111911707 |
| Molecular Formula | C22H27IN4O2S |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCc2csc(CCc3ccccc3)n2)cc1OC.I |
| InChI | InChI=1S/C22H26N4O2S.HI/c1-27-19-10-8-17(12-20(19)28-2)13-24-22(23)25-14-18-15-29-21(26-18)11-9-16-6-4-3-5-7-16;/h3-8,10,12,15H,9,11,13-14H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | WCPGZYCNRXWNDS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|