C19H21IN4S — CID 111911715
1-phenyl-2-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111911715) has the molecular formula C19H21IN4S and a molecular weight of 464.38 g/mol. Its IUPAC name is 1-phenyl-2-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-phenyl-2-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111911715 |
| Molecular Formula | C19H21IN4S |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 1-phenyl-2-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1csc(CCc2ccccc2)n1)Nc1ccccc1 |
| InChI | InChI=1S/C19H20N4S.HI/c20-19(23-16-9-5-2-6-10-16)21-13-17-14-24-18(22-17)12-11-15-7-3-1-4-8-15;/h1-10,14H,11-13H2,(H3,20,21,23);1H |
| InChIKey | CSIYPLPCAMNNLL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|