C19H26FIN4O2 — CID 111087420
1-[(3,4-dimethoxyphenyl)methyl]-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]guanidine;hydroiodide (PubChem CID 111087420) has the molecular formula C19H26FIN4O2 and a molecular weight of 488.35 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111087420 |
| Molecular Formula | C19H26FIN4O2 |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CN/C(N)=N/Cc2ccc(N(C)C)c(F)c2)cc1OC.I |
| InChI | InChI=1S/C19H25FN4O2.HI/c1-24(2)16-7-5-13(9-15(16)20)11-22-19(21)23-12-14-6-8-17(25-3)18(10-14)26-4;/h5-10H,11-12H2,1-4H3,(H3,21,22,23);1H |
| InChIKey | BEDVJESHOKRJSL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|