C20H27FN4O2 — CID 111810530
1-[(3,4-dimethoxyphenyl)methyl]-2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]guanidine (PubChem CID 111810530) has the molecular formula C20H27FN4O2 and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]guanidine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111810530 |
| Molecular Formula | C20H27FN4O2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]guanidine |
| SMILES | COc1ccc(CN/C(N)=N/Cc2ccc(F)c(CN(C)C)c2)cc1OC |
| InChI | InChI=1S/C20H27FN4O2/c1-25(2)13-16-9-14(5-7-17(16)21)11-23-20(22)24-12-15-6-8-18(26-3)19(10-15)27-4/h5-10H,11-13H2,1-4H3,(H3,22,23,24) |
| InChIKey | YVHJUFYUQADLLX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|