C13H21FN4 — CID 111087369
2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-propylguanidine (PubChem CID 111087369) has the molecular formula C13H21FN4 and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-propylguanidine.
| Compound Name | 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-propylguanidine |
|---|---|
| PubChem CID | 111087369 |
| Molecular Formula | C13H21FN4 |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-propylguanidine |
| SMILES | CCCN/C(N)=N/Cc1ccc(N(C)C)c(F)c1 |
| InChI | InChI=1S/C13H21FN4/c1-4-7-16-13(15)17-9-10-5-6-12(18(2)3)11(14)8-10/h5-6,8H,4,7,9H2,1-3H3,(H3,15,16,17) |
| InChIKey | RPYCXECXCZZQBW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|