C19H24FIN4 — CID 111087412
1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]guanidine;hydroiodide (PubChem CID 111087412) has the molecular formula C19H24FIN4 and a molecular weight of 454.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111087412 |
| Molecular Formula | C19H24FIN4 |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]guanidine;hydroiodide |
| SMILES | CN(C)c1ccc(C/N=C(\N)Nc2ccc3c(c2)CCC3)cc1F.I |
| InChI | InChI=1S/C19H23FN4.HI/c1-24(2)18-9-6-13(10-17(18)20)12-22-19(21)23-16-8-7-14-4-3-5-15(14)11-16;/h6-11H,3-5,12H2,1-2H3,(H3,21,22,23);1H |
| InChIKey | QALASCVUDDGYLJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|