C17H20IN3 — CID 111022842
2-benzyl-1-(2,3-dihydro-1H-inden-5-yl)guanidine;hydroiodide (PubChem CID 111022842) has the molecular formula C17H20IN3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2-benzyl-1-(2,3-dihydro-1H-inden-5-yl)guanidine;hydroiodide.
| Compound Name | 2-benzyl-1-(2,3-dihydro-1H-inden-5-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111022842 |
| Molecular Formula | C17H20IN3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-benzyl-1-(2,3-dihydro-1H-inden-5-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H19N3.HI/c18-17(19-12-13-5-2-1-3-6-13)20-16-10-9-14-7-4-8-15(14)11-16;/h1-3,5-6,9-11H,4,7-8,12H2,(H3,18,19,20);1H |
| InChIKey | FKLQIFCQPFCHGK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|