C23H24N4O — CID 111079793
1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine (PubChem CID 111079793) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111079793 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(Cn2ccccc2=O)cc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C23H24N4O/c24-23(26-21-12-11-19-4-3-5-20(19)14-21)25-15-17-7-9-18(10-8-17)16-27-13-2-1-6-22(27)28/h1-2,6-14H,3-5,15-16H2,(H3,24,25,26) |
| InChIKey | QLQOPTZAANDCOT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|