C25H25N5 — CID 111089241
2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine (PubChem CID 111089241) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine.
| Compound Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
|---|---|
| PubChem CID | 111089241 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
| SMILES | N/C(=N\Cc1ccc(Cn2cnc3ccccc32)cc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C25H25N5/c26-25(29-22-13-12-20-4-3-5-21(20)14-22)27-15-18-8-10-19(11-9-18)16-30-17-28-23-6-1-2-7-24(23)30/h1-2,6-14,17H,3-5,15-16H2,(H3,26,27,29) |
| InChIKey | PGEWDUHVYNXTRH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|