C23H23N5 — CID 111089217
2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-(4-methylphenyl)guanidine (PubChem CID 111089217) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-(4-methylphenyl)guanidine.
| Compound Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 111089217 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2ccc(Cn3cnc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C23H23N5/c1-17-6-12-20(13-7-17)27-23(24)25-14-18-8-10-19(11-9-18)15-28-16-26-21-4-2-3-5-22(21)28/h2-13,16H,14-15H2,1H3,(H3,24,25,27) |
| InChIKey | RVKKCGMUGNQDBK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|