C22H21N5 — CID 110926129
2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-phenylguanidine (PubChem CID 110926129) has the molecular formula C22H21N5 and a molecular weight of 355.45 g/mol. Its IUPAC name is 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-phenylguanidine.
| Compound Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 110926129 |
| Molecular Formula | C22H21N5 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-phenylguanidine |
| SMILES | N/C(=N\Cc1ccc(Cn2cnc3ccccc32)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C22H21N5/c23-22(26-19-6-2-1-3-7-19)24-14-17-10-12-18(13-11-17)15-27-16-25-20-8-4-5-9-21(20)27/h1-13,16H,14-15H2,(H3,23,24,26) |
| InChIKey | KFCVRJDRICCHQJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|