C19H20N6 — CID 111071811
1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine (PubChem CID 111071811) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111071811 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(-n2cncn2)cc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H20N6/c20-19(24-17-7-6-15-2-1-3-16(15)10-17)22-11-14-4-8-18(9-5-14)25-13-21-12-23-25/h4-10,12-13H,1-3,11H2,(H3,20,22,24) |
| InChIKey | MRXZWYHEHZEFEJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|