C20H22N6 — CID 119147450
1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine (PubChem CID 119147450) has the molecular formula C20H22N6 and a molecular weight of 346.44 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 119147450 |
| Molecular Formula | C20H22N6 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1cccc(-n2cncn2)c1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C20H22N6/c21-20(25-19-10-4-7-16-6-1-2-9-18(16)19)23-12-15-5-3-8-17(11-15)26-14-22-13-24-26/h3-5,7-8,10-11,13-14H,1-2,6,9,12H2,(H3,21,23,25) |
| InChIKey | NFEWLTSTCBSLCW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|