C18H21IN4O2 — CID 111721212
2-[(3-nitrophenyl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111721212) has the molecular formula C18H21IN4O2 and a molecular weight of 452.30 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[(3-nitrophenyl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111721212 |
| Molecular Formula | C18H21IN4O2 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-[(3-nitrophenyl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc([N+](=O)[O-])c1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C18H20N4O2.HI/c19-18(20-12-13-5-3-8-15(11-13)22(23)24)21-17-10-4-7-14-6-1-2-9-16(14)17;/h3-5,7-8,10-11H,1-2,6,9,12H2,(H3,19,20,21);1H |
| InChIKey | PMAXUEFOMFPXCI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|