C23H30N4O — CID 111721703
3-[[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]methyl]-N-tert-butylbenzamide (PubChem CID 111721703) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 3-[[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]methyl]-N-tert-butylbenzamide.
| Compound Name | 3-[[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]methyl]-N-tert-butylbenzamide |
|---|---|
| PubChem CID | 111721703 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3-[[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]methyl]-N-tert-butylbenzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(C/N=C(\N)Nc2cccc3c2CCCC3)c1 |
| InChI | InChI=1S/C23H30N4O/c1-23(2,3)27-21(28)18-11-6-8-16(14-18)15-25-22(24)26-20-13-7-10-17-9-4-5-12-19(17)20/h6-8,10-11,13-14H,4-5,9,12,15H2,1-3H3,(H,27,28)(H3,24,25,26) |
| InChIKey | AXBHHQCIKUAFKD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|