C20H26FIN4 — CID 111721522
2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111721522) has the molecular formula C20H26FIN4 and a molecular weight of 468.36 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111721522 |
| Molecular Formula | C20H26FIN4 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | CN(C)c1ccc(C/N=C(\N)Nc2cccc3c2CCCC3)cc1F.I |
| InChI | InChI=1S/C20H25FN4.HI/c1-25(2)19-11-10-14(12-17(19)21)13-23-20(22)24-18-9-5-7-15-6-3-4-8-16(15)18;/h5,7,9-12H,3-4,6,8,13H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | RRQVBWVZQTVDSL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|