C23H30FIN4O — CID 111721266
2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111721266) has the molecular formula C23H30FIN4O and a molecular weight of 524.42 g/mol. Its IUPAC name is 2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111721266 |
| Molecular Formula | C23H30FIN4O |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C23H29FN4O.HI/c24-20-14-16(8-9-22(20)28-12-10-18(29)11-13-28)15-26-23(25)27-21-7-3-5-17-4-1-2-6-19(17)21;/h3,5,7-9,14,18,29H,1-2,4,6,10-13,15H2,(H3,25,26,27);1H |
| InChIKey | DLOGTPFREJGJSE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|